C14H15F2N3O3S — CID 133338926
N-(3,4-difluorophenyl)-6-(3-hydroxypropylamino)pyridine-3-sulfonamide (PubChem CID 133338926) has the molecular formula C14H15F2N3O3S and a molecular weight of 343.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(3-hydroxypropylamino)pyridine-3-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-6-(3-hydroxypropylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133338926 |
| Molecular Formula | C14H15F2N3O3S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(3-hydroxypropylamino)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(NCCCO)nc1 |
| InChI | InChI=1S/C14H15F2N3O3S/c15-12-4-2-10(8-13(12)16)19-23(21,22)11-3-5-14(18-9-11)17-6-1-7-20/h2-5,8-9,19-20H,1,6-7H2,(H,17,18) |
| InChIKey | IXRMGEVWFKPTJL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|