C17H25N5O2S — CID 133382902
6-tert-butylsulfonyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridin-3-amine (PubChem CID 133382902) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridin-3-amine.
| Compound Name | 6-tert-butylsulfonyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133382902 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 6-tert-butylsulfonyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridin-3-amine |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc(NCc2nnc3n2CCCCC3)cn1 |
| InChI | InChI=1S/C17H25N5O2S/c1-17(2,3)25(23,24)16-9-8-13(11-19-16)18-12-15-21-20-14-7-5-4-6-10-22(14)15/h8-9,11,18H,4-7,10,12H2,1-3H3 |
| InChIKey | WONKEAOJCHNYJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |