C18H26N4 — CID 7523875
4-[(2S)-butan-2-yl]-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)aniline (PubChem CID 7523875) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)aniline.
| Compound Name | 4-[(2S)-butan-2-yl]-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 7523875 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-[(2S)-butan-2-yl]-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)aniline |
| SMILES | CC[C@H](C)c1ccc(NCc2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C18H26N4/c1-3-14(2)15-8-10-16(11-9-15)19-13-18-21-20-17-7-5-4-6-12-22(17)18/h8-11,14,19H,3-7,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | WHRDWASRWRBVOR-AWEZNQCLSA-N |
| XLogP | 4.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |