C13H19N3O5S — CID 133496467
3-[[2-(2-hydroxyethyl)cyclopentyl]amino]-5-nitrobenzenesulfonamide (PubChem CID 133496467) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-[[2-(2-hydroxyethyl)cyclopentyl]amino]-5-nitrobenzenesulfonamide.
| Compound Name | 3-[[2-(2-hydroxyethyl)cyclopentyl]amino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133496467 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[[2-(2-hydroxyethyl)cyclopentyl]amino]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(NC2CCCC2CCO)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N3O5S/c14-22(20,21)12-7-10(6-11(8-12)16(18)19)15-13-3-1-2-9(13)4-5-17/h6-9,13,15,17H,1-5H2,(H2,14,20,21) |
| InChIKey | VZIRBALLHFAURJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|