C11H13N3O5S — CID 65388072
N-cyclobutyl-3-nitro-5-sulfamoylbenzamide (PubChem CID 65388072) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is N-cyclobutyl-3-nitro-5-sulfamoylbenzamide.
| Compound Name | N-cyclobutyl-3-nitro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388072 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-cyclobutyl-3-nitro-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NC2CCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O5S/c12-20(18,19)10-5-7(4-9(6-10)14(16)17)11(15)13-8-2-1-3-8/h4-6,8H,1-3H2,(H,13,15)(H2,12,18,19) |
| InChIKey | YQHGQSBSCNQCIN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|