C15H19N3O5 — CID 4130171
N-cyclooctyl-3,5-dinitrobenzamide (PubChem CID 4130171) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is N-cyclooctyl-3,5-dinitrobenzamide.
| Compound Name | N-cyclooctyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4130171 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-cyclooctyl-3,5-dinitrobenzamide |
| SMILES | O=C(NC1CCCCCCC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N3O5/c19-15(16-12-6-4-2-1-3-5-7-12)11-8-13(17(20)21)10-14(9-11)18(22)23/h8-10,12H,1-7H2,(H,16,19) |
| InChIKey | HCUGZFVNLUGBBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|