C11H11N3O7S — CID 5182225
N-(1,1-dioxothiolan-3-yl)-3,5-dinitrobenzamide (PubChem CID 5182225) has the molecular formula C11H11N3O7S and a molecular weight of 329.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 5182225 |
| Molecular Formula | C11H11N3O7S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3,5-dinitrobenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O7S/c15-11(12-8-1-2-22(20,21)6-8)7-3-9(13(16)17)5-10(4-7)14(18)19/h3-5,8H,1-2,6H2,(H,12,15) |
| InChIKey | MVMKMIUFQUSEIL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|