C10H10ClN3O5S — CID 103803501
2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitropyridine-3-carboxamide (PubChem CID 103803501) has the molecular formula C10H10ClN3O5S and a molecular weight of 319.73 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103803501 |
| Molecular Formula | C10H10ClN3O5S |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitropyridine-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C10H10ClN3O5S/c11-9-8(3-7(4-12-9)14(16)17)10(15)13-6-1-2-20(18,19)5-6/h3-4,6H,1-2,5H2,(H,13,15) |
| InChIKey | FNEIZZBVLAXZOI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|