C17H15FN2O5S2 — CID 55477806
N-(1,1-dioxothiolan-3-yl)-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide (PubChem CID 55477806) has the molecular formula C17H15FN2O5S2 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55477806 |
| Molecular Formula | C17H15FN2O5S2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc([N+](=O)[O-])ccc1Sc1ccccc1F |
| InChI | InChI=1S/C17H15FN2O5S2/c18-14-3-1-2-4-16(14)26-15-6-5-12(20(22)23)9-13(15)17(21)19-11-7-8-27(24,25)10-11/h1-6,9,11H,7-8,10H2,(H,19,21) |
| InChIKey | GUONXWDNYAZEAW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|