C11H13N3O6S — CID 6598448
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(2-hydroxy-5-nitrophenyl)urea (PubChem CID 6598448) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(2-hydroxy-5-nitrophenyl)urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(2-hydroxy-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 6598448 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(2-hydroxy-5-nitrophenyl)urea |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13N3O6S/c15-10-2-1-8(14(17)18)5-9(10)13-11(16)12-7-3-4-21(19,20)6-7/h1-2,5,7,15H,3-4,6H2,(H2,12,13,16)/t7-/m0/s1 |
| InChIKey | FCBUEUZGYQPIRN-ZETCQYMHSA-N |
| XLogP | 0.61 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|