C12H15N3O6S — CID 7041338
1-(2-hydroxy-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea (PubChem CID 7041338) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1-(2-hydroxy-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2-hydroxy-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 7041338 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-(2-hydroxy-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
| SMILES | C[C@]1(NC(=O)Nc2cc([N+](=O)[O-])ccc2O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15N3O6S/c1-12(4-5-22(20,21)7-12)14-11(17)13-9-6-8(15(18)19)2-3-10(9)16/h2-3,6,16H,4-5,7H2,1H3,(H2,13,14,17)/t12-/m0/s1 |
| InChIKey | LJQMJEBYJPWNJJ-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|