C12H15ClN2O3S — CID 43827990
1-(4-chlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea (PubChem CID 43827990) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 43827990 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
| SMILES | CC1(NC(=O)Nc2ccc(Cl)cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-12(6-7-19(17,18)8-12)15-11(16)14-10-4-2-9(13)3-5-10/h2-5H,6-8H2,1H3,(H2,14,15,16) |
| InChIKey | ONDQFZVKXNDRCA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |