C19H20ClN3O4S — CID 102566687
4-chloro-N-[4-[(3-methyl-1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]benzamide (PubChem CID 102566687) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 4-chloro-N-[4-[(3-methyl-1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[(3-methyl-1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 102566687 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-chloro-N-[4-[(3-methyl-1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]benzamide |
| SMILES | CC1(NC(=O)Nc2ccc(NC(=O)c3ccc(Cl)cc3)cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-19(10-11-28(26,27)12-19)23-18(25)22-16-8-6-15(7-9-16)21-17(24)13-2-4-14(20)5-3-13/h2-9H,10-12H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | DTPFRTOGPUPHAV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |