C12H14Cl2N2O3S — CID 136515060
1-(3,5-dichlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea (PubChem CID 136515060) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 136515060 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
| SMILES | CC1(NC(=O)Nc2cc(Cl)cc(Cl)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-12(2-3-20(18,19)7-12)16-11(17)15-10-5-8(13)4-9(14)6-10/h4-6H,2-3,7H2,1H3,(H2,15,16,17) |
| InChIKey | IXWBZDQLEZKKGS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |