C7H13NO4S — CID 16768977
2-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 16768977) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 16768977 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC1(NC(=O)CO)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO4S/c1-7(8-6(10)4-9)2-3-13(11,12)5-7/h9H,2-5H2,1H3,(H,8,10) |
| InChIKey | QLDZYZOESDEEQA-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |