C9H16ClNO3S — CID 62727568
3-chloro-2-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)propanamide (PubChem CID 62727568) has the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-chloro-2-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 62727568 |
| Molecular Formula | C9H16ClNO3S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-chloro-2-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(CCl)C(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16ClNO3S/c1-7(5-10)8(12)11-9(2)3-4-15(13,14)6-9/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | RYXJFYVGPWAECC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|