About 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide
5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide (PubChem CID 82848148) has the molecular formula C11H22N2O3S
and a molecular weight of 262.37 g/mol. Its IUPAC name is 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide.
Molecular Properties
| Compound Name | 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide |
| PubChem CID | 82848148 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide |
| SMILES | CC(N)CCCC(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-9(12)4-3-5-10(14)13-11(2)6-7-17(15,16)8-11/h9H,3-8,12H2,1-2H3,(H,13,14) |
| InChIKey | OGGAJNADKVBMHZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide?
The IUPAC name of 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide (CID 82848148) is 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide.
What is the SMILES notation for 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide?
The canonical SMILES for 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide is CC(N)CCCC(=O)NC1(C)CCS(=O)(=O)C1.
What is the InChIKey of 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide?
The InChIKey is OGGAJNADKVBMHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-9(12)4-3-5-10(14)13-11(2)6-7-17(15,16)8-11/h9H,3-8,12H2,1-2H3,(H,13,14).
What are the key properties of 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide?
5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide has a molecular weight of 262.37 g/mol, XLogP of 0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(3-methyl-1,1-dioxothiolan-3-yl)hexanamide is sourced from PubChem (CID 82848148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).