C17H25NO5S — CID 8849501
4-(4-ethoxyphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide (PubChem CID 8849501) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-(4-ethoxyphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide.
| Compound Name | 4-(4-ethoxyphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
|---|---|
| PubChem CID | 8849501 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-(4-ethoxyphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
| SMILES | CCOc1ccc(OCCCC(=O)N[C@@]2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-3-22-14-6-8-15(9-7-14)23-11-4-5-16(19)18-17(2)10-12-24(20,21)13-17/h6-9H,3-5,10-13H2,1-2H3,(H,18,19)/t17-/m0/s1 |
| InChIKey | VYXVHHUVSGAUNF-KRWDZBQOSA-N |
| XLogP | 1.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|