C19H29NO4S — CID 8571377
4-(4-tert-butylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide (PubChem CID 8571377) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
|---|---|
| PubChem CID | 8571377 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)N[C@@]2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-18(2,3)15-7-9-16(10-8-15)24-12-5-6-17(21)20-19(4)11-13-25(22,23)14-19/h7-10H,5-6,11-14H2,1-4H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | YMFLKHHSJXQBKZ-IBGZPJMESA-N |
| XLogP | 2.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|