C17H25NO4S — CID 51146186
4-(3-methylbutoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide (PubChem CID 51146186) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-(3-methylbutoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 51146186 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-(3-methylbutoxy)-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H25NO4S/c1-13(2)8-10-22-15-6-4-14(5-7-15)16(19)18-17(3)9-11-23(20,21)12-17/h4-7,13H,8-12H2,1-3H3,(H,18,19) |
| InChIKey | DMWMUVBYGUJAQS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |