C14H18NO4- — CID 6944071
2-[[4-(3-methylbutoxy)benzoyl]amino]acetate (PubChem CID 6944071) has the molecular formula C14H18NO4- and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[[4-(3-methylbutoxy)benzoyl]amino]acetate.
| Compound Name | 2-[[4-(3-methylbutoxy)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 6944071 |
| Molecular Formula | C14H18NO4- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[[4-(3-methylbutoxy)benzoyl]amino]acetate |
| SMILES | CC(C)CCOc1ccc(C(=O)NCC(=O)[O-])cc1 |
| InChI | InChI=1S/C14H19NO4/c1-10(2)7-8-19-12-5-3-11(4-6-12)14(18)15-9-13(16)17/h3-6,10H,7-9H2,1-2H3,(H,15,18)(H,16,17)/p-1 |
| InChIKey | WOLNIDACGLPVHC-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |