C10H10NO4- — CID 6920131
2-[(4-methoxybenzoyl)amino]acetate (PubChem CID 6920131) has the molecular formula C10H10NO4- and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]acetate.
| Compound Name | 2-[(4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 6920131 |
| Molecular Formula | C10H10NO4- |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO4/c1-15-8-4-2-7(3-5-8)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13)/p-1 |
| InChIKey | SIEIOUWSTGWJGE-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |