About (4-methoxyphenyl) 2-benzamidoacetate
(4-methoxyphenyl) 2-benzamidoacetate (PubChem CID 23275662) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-benzamidoacetate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 2-benzamidoacetate |
| PubChem CID | 23275662 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (4-methoxyphenyl) 2-benzamidoacetate |
| SMILES | COc1ccc(OC(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-20-13-7-9-14(10-8-13)21-15(18)11-17-16(19)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,17,19) |
| InChIKey | XMOYAFMDGFRGDX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 2-benzamidoacetate?
The IUPAC name of (4-methoxyphenyl) 2-benzamidoacetate (CID 23275662) is (4-methoxyphenyl) 2-benzamidoacetate.
What is the SMILES notation for (4-methoxyphenyl) 2-benzamidoacetate?
The canonical SMILES for (4-methoxyphenyl) 2-benzamidoacetate is COc1ccc(OC(=O)CNC(=O)c2ccccc2)cc1.
What is the InChIKey of (4-methoxyphenyl) 2-benzamidoacetate?
The InChIKey is XMOYAFMDGFRGDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-20-13-7-9-14(10-8-13)21-15(18)11-17-16(19)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,17,19).
What are the key properties of (4-methoxyphenyl) 2-benzamidoacetate?
(4-methoxyphenyl) 2-benzamidoacetate has a molecular weight of 285.30 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 2-benzamidoacetate is sourced from PubChem (CID 23275662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).