C19H20N2O5 — CID 2625536
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-benzamidoacetate (PubChem CID 2625536) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2625536 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-benzamidoacetate |
| SMILES | COc1ccc(CNC(=O)COC(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-25-16-9-7-14(8-10-16)11-20-17(22)13-26-18(23)12-21-19(24)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | IFUJIHVBVBJZFO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |