C14H18N2O5 — CID 71129478
N-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]amino]-2-oxoethyl]-4-methoxybenzamide (PubChem CID 71129478) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]amino]-2-oxoethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]amino]-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 71129478 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[2-[[(2S)-1-hydroxy-3-oxobutan-2-yl]amino]-2-oxoethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)N[C@@H](CO)C(C)=O)cc1 |
| InChI | InChI=1S/C14H18N2O5/c1-9(18)12(8-17)16-13(19)7-15-14(20)10-3-5-11(21-2)6-4-10/h3-6,12,17H,7-8H2,1-2H3,(H,15,20)(H,16,19)/t12-/m0/s1 |
| InChIKey | FAPICEWURPXKKU-LBPRGKRZSA-N |
| XLogP | -0.51 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |