C17H24N2O6 — CID 75413045
methyl 2-[[2-[(4-butoxybenzoyl)amino]acetyl]amino]-3-hydroxypropanoate (PubChem CID 75413045) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 2-[[2-[(4-butoxybenzoyl)amino]acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-[(4-butoxybenzoyl)amino]acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 75413045 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | methyl 2-[[2-[(4-butoxybenzoyl)amino]acetyl]amino]-3-hydroxypropanoate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NC(CO)C(=O)OC)cc1 |
| InChI | InChI=1S/C17H24N2O6/c1-3-4-9-25-13-7-5-12(6-8-13)16(22)18-10-15(21)19-14(11-20)17(23)24-2/h5-8,14,20H,3-4,9-11H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | ZBMYFKUGMIJVMH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|