C20H22ClN3O4 — CID 7971592
4-butoxy-N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 7971592) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is 4-butoxy-N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 7971592 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 4-butoxy-N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-2-3-12-28-17-10-6-14(7-11-17)19(26)22-13-18(25)23-24-20(27)15-4-8-16(21)9-5-15/h4-11H,2-3,12-13H2,1H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | XOPGHBVXWBCDGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|