C18H21N3O4S — CID 7979296
4-butoxy-N-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]benzamide (PubChem CID 7979296) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-butoxy-N-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 7979296 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-butoxy-N-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-2-3-10-25-14-8-6-13(7-9-14)17(23)19-12-16(22)20-21-18(24)15-5-4-11-26-15/h4-9,11H,2-3,10,12H2,1H3,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | QDMYSQOSZXZTGG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|