C24H18N4O5S2 — CID 2204112
N'-[4-[4-[(thiophene-2-carbonylamino)carbamoyl]phenoxy]benzoyl]thiophene-2-carbohydrazide (PubChem CID 2204112) has the molecular formula C24H18N4O5S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is N'-[4-[4-[(thiophene-2-carbonylamino)carbamoyl]phenoxy]benzoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[4-[4-[(thiophene-2-carbonylamino)carbamoyl]phenoxy]benzoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2204112 |
| Molecular Formula | C24H18N4O5S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | N'-[4-[4-[(thiophene-2-carbonylamino)carbamoyl]phenoxy]benzoyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc(Oc2ccc(C(=O)NNC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C24H18N4O5S2/c29-21(25-27-23(31)19-3-1-13-34-19)15-5-9-17(10-6-15)33-18-11-7-16(8-12-18)22(30)26-28-24(32)20-4-2-14-35-20/h1-14H,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | DFIPBCLHBFTMJT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|