C12H11N3O3S — CID 27018409
6-methoxy-N'-(thiophene-2-carbonyl)pyridine-3-carbohydrazide (PubChem CID 27018409) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 6-methoxy-N'-(thiophene-2-carbonyl)pyridine-3-carbohydrazide.
| Compound Name | 6-methoxy-N'-(thiophene-2-carbonyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27018409 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 6-methoxy-N'-(thiophene-2-carbonyl)pyridine-3-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C12H11N3O3S/c1-18-10-5-4-8(7-13-10)11(16)14-15-12(17)9-3-2-6-19-9/h2-7H,1H3,(H,14,16)(H,15,17) |
| InChIKey | ZGJFUNKIGJHPKY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|