C14H12ClN3O3 — CID 27007451
N'-(4-chlorobenzoyl)-6-methoxypyridine-3-carbohydrazide (PubChem CID 27007451) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-6-methoxypyridine-3-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-6-methoxypyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27007451 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N'-(4-chlorobenzoyl)-6-methoxypyridine-3-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C14H12ClN3O3/c1-21-12-7-4-10(8-16-12)14(20)18-17-13(19)9-2-5-11(15)6-3-9/h2-8H,1H3,(H,17,19)(H,18,20) |
| InChIKey | FUCRORXRMZJCMO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|