C12H11BrN4O3 — CID 39447654
N'-(4-bromo-1H-pyrrole-2-carbonyl)-6-methoxypyridine-3-carbohydrazide (PubChem CID 39447654) has the molecular formula C12H11BrN4O3 and a molecular weight of 339.15 g/mol. Its IUPAC name is N'-(4-bromo-1H-pyrrole-2-carbonyl)-6-methoxypyridine-3-carbohydrazide.
| Compound Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-6-methoxypyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 39447654 |
| Molecular Formula | C12H11BrN4O3 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-6-methoxypyridine-3-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)cn1 |
| InChI | InChI=1S/C12H11BrN4O3/c1-20-10-3-2-7(5-15-10)11(18)16-17-12(19)9-4-8(13)6-14-9/h2-6,14H,1H3,(H,16,18)(H,17,19) |
| InChIKey | XFSANZZABCKQBN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|