C11H8Br2N4O2 — CID 9255864
5-bromo-N'-(4-bromo-1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide (PubChem CID 9255864) has the molecular formula C11H8Br2N4O2 and a molecular weight of 388.02 g/mol. Its IUPAC name is 5-bromo-N'-(4-bromo-1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide.
| Compound Name | 5-bromo-N'-(4-bromo-1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 9255864 |
| Molecular Formula | C11H8Br2N4O2 |
| Molecular Weight | 388.02 g/mol |
| Exact Mass | 385.90 |
| IUPAC Name | 5-bromo-N'-(4-bromo-1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Br)c[nH]1)c1cncc(Br)c1 |
| InChI | InChI=1S/C11H8Br2N4O2/c12-7-1-6(3-14-4-7)10(18)16-17-11(19)9-2-8(13)5-15-9/h1-5,15H,(H,16,18)(H,17,19) |
| InChIKey | NMWMXYNHKITZRN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.02 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|