C10H9BrN4O3 — CID 31598667
N'-(4-bromo-1H-pyrrole-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide (PubChem CID 31598667) has the molecular formula C10H9BrN4O3 and a molecular weight of 313.11 g/mol. Its IUPAC name is N'-(4-bromo-1H-pyrrole-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 31598667 |
| Molecular Formula | C10H9BrN4O3 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(Br)c[nH]2)on1 |
| InChI | InChI=1S/C10H9BrN4O3/c1-5-2-8(18-15-5)10(17)14-13-9(16)7-3-6(11)4-12-7/h2-4,12H,1H3,(H,13,16)(H,14,17) |
| InChIKey | UPURHBLVHPARBX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|