C12H11N3O4 — CID 51250800
N'-(2-hydroxybenzoyl)-3-methyl-1,2-oxazole-5-carbohydrazide (PubChem CID 51250800) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-3-methyl-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 51250800 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2O)on1 |
| InChI | InChI=1S/C12H11N3O4/c1-7-6-10(19-15-7)12(18)14-13-11(17)8-4-2-3-5-9(8)16/h2-6,16H,1H3,(H,13,17)(H,14,18) |
| InChIKey | MIPQXGDCXYKQBC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|