C18H15N3O3 — CID 43911460
N-(4-benzamidophenyl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 43911460) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-(4-benzamidophenyl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-benzamidophenyl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 43911460 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(4-benzamidophenyl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)on1 |
| InChI | InChI=1S/C18H15N3O3/c1-12-11-16(24-21-12)18(23)20-15-9-7-14(8-10-15)19-17(22)13-5-3-2-4-6-13/h2-11H,1H3,(H,19,22)(H,20,23) |
| InChIKey | DCLSKCLNTCWNJV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |