C12H11N3O3 — CID 21432228
N-(4-carbamoylphenyl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 21432228) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 21432228 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(4-carbamoylphenyl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(N)=O)cc2)on1 |
| InChI | InChI=1S/C12H11N3O3/c1-7-6-10(18-15-7)12(17)14-9-4-2-8(3-5-9)11(13)16/h2-6H,1H3,(H2,13,16)(H,14,17) |
| InChIKey | KWEIWWLOGGPONR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |