About N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide
N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 43911440) has the molecular formula C16H19N3O4
and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 43911440 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)c2cc(C)no2)cc1 |
| InChI | InChI=1S/C16H19N3O4/c1-11-10-14(23-19-11)16(21)18-13-6-4-12(5-7-13)15(20)17-8-3-9-22-2/h4-7,10H,3,8-9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | SWWUGFWBAZLYBW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide (CID 43911440) is N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide is COCCCNC(=O)c1ccc(NC(=O)c2cc(C)no2)cc1.
What is the InChIKey of N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is SWWUGFWBAZLYBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-11-10-14(23-19-11)16(21)18-13-6-4-12(5-7-13)15(20)17-8-3-9-22-2/h4-7,10H,3,8-9H2,1-2H3,(H,17,20)(H,18,21).
What are the key properties of N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide?
N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 317.35 g/mol, XLogP of 2.00, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 43911440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).