C12H13N3O2 — CID 104954922
N-[4-(aminomethyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 104954922) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 104954922 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(CN)cc2)on1 |
| InChI | InChI=1S/C12H13N3O2/c1-8-6-11(17-15-8)12(16)14-10-4-2-9(7-13)3-5-10/h2-6H,7,13H2,1H3,(H,14,16) |
| InChIKey | NNSNJRFKJSUULT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |