C11H9FN2O2 — CID 16606648
N-(3-fluorophenyl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 16606648) has the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16606648 |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | N-(3-fluorophenyl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(F)c2)on1 |
| InChI | InChI=1S/C11H9FN2O2/c1-7-5-10(16-14-7)11(15)13-9-4-2-3-8(12)6-9/h2-6H,1H3,(H,13,15) |
| InChIKey | HZLTUTVWPMOBGN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |