C15H12N4O2 — CID 134009492
3-methyl-N-(2-phenylpyrimidin-5-yl)-1,2-oxazole-5-carboxamide (PubChem CID 134009492) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-methyl-N-(2-phenylpyrimidin-5-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(2-phenylpyrimidin-5-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 134009492 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-methyl-N-(2-phenylpyrimidin-5-yl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cnc(-c3ccccc3)nc2)on1 |
| InChI | InChI=1S/C15H12N4O2/c1-10-7-13(21-19-10)15(20)18-12-8-16-14(17-9-12)11-5-3-2-4-6-11/h2-9H,1H3,(H,18,20) |
| InChIKey | CLSQISKAJJAUTE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |