C10H8BrN3O3S — CID 31729161
N'-(5-bromothiophene-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide (PubChem CID 31729161) has the molecular formula C10H8BrN3O3S and a molecular weight of 330.16 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 31729161 |
| Molecular Formula | C10H8BrN3O3S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(Br)s2)on1 |
| InChI | InChI=1S/C10H8BrN3O3S/c1-5-4-6(17-14-5)9(15)12-13-10(16)7-2-3-8(11)18-7/h2-4H,1H3,(H,12,15)(H,13,16) |
| InChIKey | HWIRQWPFFFHCCW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|