C12H10BrN3O2S — CID 32770697
N'-(5-bromothiophene-2-carbonyl)-6-methylpyridine-3-carbohydrazide (PubChem CID 32770697) has the molecular formula C12H10BrN3O2S and a molecular weight of 340.20 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-6-methylpyridine-3-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-6-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 32770697 |
| Molecular Formula | C12H10BrN3O2S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-6-methylpyridine-3-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C12H10BrN3O2S/c1-7-2-3-8(6-14-7)11(17)15-16-12(18)9-4-5-10(13)19-9/h2-6H,1H3,(H,15,17)(H,16,18) |
| InChIKey | JNPNHTJSAZULHF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|