C11H10BrN3O3S — CID 9154627
N'-(5-bromothiophene-2-carbonyl)-3,5-dimethyl-1,2-oxazole-4-carbohydrazide (PubChem CID 9154627) has the molecular formula C11H10BrN3O3S and a molecular weight of 344.19 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-3,5-dimethyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-3,5-dimethyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9154627 |
| Molecular Formula | C11H10BrN3O3S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-3,5-dimethyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1noc(C)c1C(=O)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H10BrN3O3S/c1-5-9(6(2)18-15-5)11(17)14-13-10(16)7-3-4-8(12)19-7/h3-4H,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | OFMLXNRFCFWQGM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|