C13H13BrN2O3S — CID 26784732
N'-(5-bromothiophene-2-carbonyl)-2,4,5-trimethylfuran-3-carbohydrazide (PubChem CID 26784732) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-2,4,5-trimethylfuran-3-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-2,4,5-trimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26784732 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-2,4,5-trimethylfuran-3-carbohydrazide |
| SMILES | Cc1oc(C)c(C(=O)NNC(=O)c2ccc(Br)s2)c1C |
| InChI | InChI=1S/C13H13BrN2O3S/c1-6-7(2)19-8(3)11(6)13(18)16-15-12(17)9-4-5-10(14)20-9/h4-5H,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | RZIUMLUEPNDGBL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|