C15H15BrN2O2S — CID 31950441
5-bromo-N'-[3-(4-methylphenyl)propanoyl]thiophene-2-carbohydrazide (PubChem CID 31950441) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 5-bromo-N'-[3-(4-methylphenyl)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[3-(4-methylphenyl)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 31950441 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 5-bromo-N'-[3-(4-methylphenyl)propanoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ccc(CCC(=O)NNC(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C15H15BrN2O2S/c1-10-2-4-11(5-3-10)6-9-14(19)17-18-15(20)12-7-8-13(16)21-12/h2-5,7-8H,6,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | XPCTUTAEBSTRRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|