C15H13BrN2O4S — CID 4789829
5-bromo-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 4789829) has the molecular formula C15H13BrN2O4S and a molecular weight of 397.25 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4789829 |
| Molecular Formula | C15H13BrN2O4S |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 5-bromo-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H13BrN2O4S/c16-13-4-3-12(23-13)15(20)18-17-14(19)8-9-1-2-10-11(7-9)22-6-5-21-10/h1-4,7H,5-6,8H2,(H,17,19)(H,18,20) |
| InChIKey | NKGQAHYMAZIHIH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|