C20H22N2O5 — CID 18159237
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide (PubChem CID 18159237) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 18159237 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)Cc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-2-14-3-6-16(7-4-14)27-13-20(24)22-21-19(23)12-15-5-8-17-18(11-15)26-10-9-25-17/h3-8,11H,2,9-10,12-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | GCKDZTPMDNDMBW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|