C21H22N2O5 — CID 9472049
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 9472049) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9472049 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(4-ethylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)/C=C/c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-2-15-3-7-17(8-4-15)28-14-21(25)23-22-20(24)10-6-16-5-9-18-19(13-16)27-12-11-26-18/h3-10,13H,2,11-12,14H2,1H3,(H,22,24)(H,23,25)/b10-6+ |
| InChIKey | KXJKBRHHPNFBLM-UXBLZVDNSA-N |
| XLogP | 2.26 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|