C22H24N2O7 — CID 4932704
ethyl 4-[2-[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 4932704) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is ethyl 4-[2-[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 4-[2-[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 4932704 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | ethyl 4-[2-[2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)NNC(=O)C=Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H24N2O7/c1-4-30-22(27)16-7-9-17(10-8-16)31-14-21(26)24-23-20(25)12-6-15-5-11-18(28-2)19(13-15)29-3/h5-13H,4,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | NFIWYKIULNWNDB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|